C23H30FNO3 — CID 160830593
(6aR)-2-(3-fluoropropoxy)-6-propyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;methane (PubChem CID 160830593) has the molecular formula C23H30FNO3 and a molecular weight of 387.50 g/mol. Its IUPAC name is (6aR)-2-(3-fluoropropoxy)-6-propyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;methane.
| Compound Name | (6aR)-2-(3-fluoropropoxy)-6-propyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;methane |
|---|---|
| PubChem CID | 160830593 |
| Molecular Formula | C23H30FNO3 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (6aR)-2-(3-fluoropropoxy)-6-propyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;methane |
| SMILES | C.CCCN1CCc2cc(OCCCF)cc3c2[C@H]1Cc1ccc(O)c(O)c1-3 |
| InChI | InChI=1S/C22H26FNO3.CH4/c1-2-8-24-9-6-15-11-16(27-10-3-7-23)13-17-20(15)18(24)12-14-4-5-19(25)22(26)21(14)17;/h4-5,11,13,18,25-26H,2-3,6-10,12H2,1H3;1H4/t18-;/m1./s1 |
| InChIKey | SGTCDVUMQPCLMY-GMUIIQOCSA-N |
| XLogP | 5.00 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|