C29H22F2N2O2 — CID 24805100
1-benzyl-N-[(3,5-difluorophenyl)methyl]-5-hydroxy-2-phenylindole-3-carboxamide (PubChem CID 24805100) has the molecular formula C29H22F2N2O2 and a molecular weight of 468.50 g/mol. Its IUPAC name is 1-benzyl-N-[(3,5-difluorophenyl)methyl]-5-hydroxy-2-phenylindole-3-carboxamide.
| Compound Name | 1-benzyl-N-[(3,5-difluorophenyl)methyl]-5-hydroxy-2-phenylindole-3-carboxamide |
|---|---|
| PubChem CID | 24805100 |
| Molecular Formula | C29H22F2N2O2 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 1-benzyl-N-[(3,5-difluorophenyl)methyl]-5-hydroxy-2-phenylindole-3-carboxamide |
| SMILES | O=C(NCc1cc(F)cc(F)c1)c1c(-c2ccccc2)n(Cc2ccccc2)c2ccc(O)cc12 |
| InChI | InChI=1S/C29H22F2N2O2/c30-22-13-20(14-23(31)15-22)17-32-29(35)27-25-16-24(34)11-12-26(25)33(18-19-7-3-1-4-8-19)28(27)21-9-5-2-6-10-21/h1-16,34H,17-18H2,(H,32,35) |
| InChIKey | LQNBNILQVNJQHD-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |