About 8-iodo-1-phenyl-1,2-dihydrobenzo[f]chromen-3-one
8-iodo-1-phenyl-1,2-dihydrobenzo[f]chromen-3-one (PubChem CID 24805831) has the molecular formula C19H13IO2
and a molecular weight of 400.22 g/mol. Its IUPAC name is 8-iodo-1-phenyl-1,2-dihydrobenzo[f]chromen-3-one.
Molecular Properties
| Compound Name | 8-iodo-1-phenyl-1,2-dihydrobenzo[f]chromen-3-one |
| PubChem CID | 24805831 |
| Molecular Formula | C19H13IO2 |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 8-iodo-1-phenyl-1,2-dihydrobenzo[f]chromen-3-one |
| SMILES | O=C1CC(c2ccccc2)c2c(ccc3cc(I)ccc23)O1 |
| InChI | InChI=1S/C19H13IO2/c20-14-7-8-15-13(10-14)6-9-17-19(15)16(11-18(21)22-17)12-4-2-1-3-5-12/h1-10,16H,11H2 |
| InChIKey | XZVXPALQXOBYFD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 8-iodo-1-phenyl-1,2-dihydrobenzo[f]chromen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-iodo-1-phenyl-1,2-dihydrobenzo[f]chromen-3-one?
The IUPAC name of 8-iodo-1-phenyl-1,2-dihydrobenzo[f]chromen-3-one (CID 24805831) is 8-iodo-1-phenyl-1,2-dihydrobenzo[f]chromen-3-one.
What is the SMILES notation for 8-iodo-1-phenyl-1,2-dihydrobenzo[f]chromen-3-one?
The canonical SMILES for 8-iodo-1-phenyl-1,2-dihydrobenzo[f]chromen-3-one is O=C1CC(c2ccccc2)c2c(ccc3cc(I)ccc23)O1.
What is the InChIKey of 8-iodo-1-phenyl-1,2-dihydrobenzo[f]chromen-3-one?
The InChIKey is XZVXPALQXOBYFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13IO2/c20-14-7-8-15-13(10-14)6-9-17-19(15)16(11-18(21)22-17)12-4-2-1-3-5-12/h1-10,16H,11H2.
What are the key properties of 8-iodo-1-phenyl-1,2-dihydrobenzo[f]chromen-3-one?
8-iodo-1-phenyl-1,2-dihydrobenzo[f]chromen-3-one has a molecular weight of 400.22 g/mol, XLogP of 4.89, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-iodo-1-phenyl-1,2-dihydrobenzo[f]chromen-3-one is sourced from PubChem (CID 24805831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).