C19H13IO2 — CID 24805831
8-iodo-1-phenyl-1,2-dihydrobenzo[f]chromen-3-one (PubChem CID 24805831) has the molecular formula C19H13IO2 and a molecular weight of 400.22 g/mol. Its IUPAC name is 8-iodo-1-phenyl-1,2-dihydrobenzo[f]chromen-3-one.
| Compound Name | 8-iodo-1-phenyl-1,2-dihydrobenzo[f]chromen-3-one |
|---|---|
| PubChem CID | 24805831 |
| Molecular Formula | C19H13IO2 |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 8-iodo-1-phenyl-1,2-dihydrobenzo[f]chromen-3-one |
| SMILES | O=C1CC(c2ccccc2)c2c(ccc3cc(I)ccc23)O1 |
| InChI | InChI=1S/C19H13IO2/c20-14-7-8-15-13(10-14)6-9-17-19(15)16(11-18(21)22-17)12-4-2-1-3-5-12/h1-10,16H,11H2 |
| InChIKey | XZVXPALQXOBYFD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|