C20H22N6O5S — CID 24818119
N-[3-(diethylsulfamoyl)-4-methylphenyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 24818119) has the molecular formula C20H22N6O5S and a molecular weight of 458.50 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-methylphenyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 24818119 |
| Molecular Formula | C20H22N6O5S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)c2ccc(-n3cncn3)c([N+](=O)[O-])c2)ccc1C |
| InChI | InChI=1S/C20H22N6O5S/c1-4-24(5-2)32(30,31)19-11-16(8-6-14(19)3)23-20(27)15-7-9-17(18(10-15)26(28)29)25-13-21-12-22-25/h6-13H,4-5H2,1-3H3,(H,23,27) |
| InChIKey | OXICZWYGYDPQED-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 140.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|