C18H18N6O5S — CID 25102437
N-[5-(dimethylsulfamoyl)-2-methylphenyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 25102437) has the molecular formula C18H18N6O5S and a molecular weight of 430.45 g/mol. Its IUPAC name is N-[5-(dimethylsulfamoyl)-2-methylphenyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[5-(dimethylsulfamoyl)-2-methylphenyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 25102437 |
| Molecular Formula | C18H18N6O5S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | N-[5-(dimethylsulfamoyl)-2-methylphenyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)c1ccc(-n2cncn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H18N6O5S/c1-12-4-6-14(30(28,29)22(2)3)9-15(12)21-18(25)13-5-7-16(17(8-13)24(26)27)23-11-19-10-20-23/h4-11H,1-3H3,(H,21,25) |
| InChIKey | VWCVDLZUORVJNV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 140.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|