C15H9F2N5O3 — CID 25162576
N-(3,4-difluorophenyl)-3-nitro-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 25162576) has the molecular formula C15H9F2N5O3 and a molecular weight of 345.27 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-3-nitro-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-(3,4-difluorophenyl)-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 25162576 |
| Molecular Formula | C15H9F2N5O3 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N-(3,4-difluorophenyl)-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1ccc(-n2cncn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H9F2N5O3/c16-11-3-2-10(6-12(11)17)20-15(23)9-1-4-13(14(5-9)22(24)25)21-8-18-7-19-21/h1-8H,(H,20,23) |
| InChIKey | KOMKGJUGSRJYAA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|