C19H16F2N6O5S — CID 24981065
[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-[3-nitro-4-(1,2,4-triazol-1-yl)phenyl]methanone (PubChem CID 24981065) has the molecular formula C19H16F2N6O5S and a molecular weight of 478.44 g/mol. Its IUPAC name is [4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-[3-nitro-4-(1,2,4-triazol-1-yl)phenyl]methanone.
| Compound Name | [4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-[3-nitro-4-(1,2,4-triazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 24981065 |
| Molecular Formula | C19H16F2N6O5S |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | [4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-[3-nitro-4-(1,2,4-triazol-1-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(-n2cncn2)c([N+](=O)[O-])c1)N1CCN(S(=O)(=O)c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C19H16F2N6O5S/c20-14-2-1-3-15(21)18(14)33(31,32)25-8-6-24(7-9-25)19(28)13-4-5-16(17(10-13)27(29)30)26-12-22-11-23-26/h1-5,10-12H,6-9H2 |
| InChIKey | LNANFPBRIYYFNF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 131.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|