C24H28N2O4 — CID 24830834
3-[[1-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-7-methylindol-4-yl]amino]-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 24830834) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 3-[[1-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-7-methylindol-4-yl]amino]-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-[[1-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-7-methylindol-4-yl]amino]-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 24830834 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 3-[[1-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-7-methylindol-4-yl]amino]-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | Cc1ccc(NC(=O)C(C)(C)C(=O)O)c2ccn(Cc3ccc(O)c(C(C)C)c3)c12 |
| InChI | InChI=1S/C24H28N2O4/c1-14(2)18-12-16(7-9-20(18)27)13-26-11-10-17-19(8-6-15(3)21(17)26)25-22(28)24(4,5)23(29)30/h6-12,14,27H,13H2,1-5H3,(H,25,28)(H,29,30) |
| InChIKey | HKJWEQYVTVJSEL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|