About 6-(4-methoxyphenyl)-8-methyl-2,3-dihydroimidazo[1,2-b]pyridazine;hydrochloride
6-(4-methoxyphenyl)-8-methyl-2,3-dihydroimidazo[1,2-b]pyridazine;hydrochloride (PubChem CID 24839118) has the molecular formula C14H16ClN3O
and a molecular weight of 277.76 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-8-methyl-2,3-dihydroimidazo[1,2-b]pyridazine;hydrochloride.
Molecular Properties
| Compound Name | 6-(4-methoxyphenyl)-8-methyl-2,3-dihydroimidazo[1,2-b]pyridazine;hydrochloride |
| PubChem CID | 24839118 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 6-(4-methoxyphenyl)-8-methyl-2,3-dihydroimidazo[1,2-b]pyridazine;hydrochloride |
| SMILES | COc1ccc(C2=NN3CCN=C3C(C)=C2)cc1.Cl |
| InChI | InChI=1S/C14H15N3O.ClH/c1-10-9-13(16-17-8-7-15-14(10)17)11-3-5-12(18-2)6-4-11;/h3-6,9H,7-8H2,1-2H3;1H |
| InChIKey | FEARIBWEEZCUQS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(4-methoxyphenyl)-8-methyl-2,3-dihydroimidazo[1,2-b]pyridazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-methoxyphenyl)-8-methyl-2,3-dihydroimidazo[1,2-b]pyridazine;hydrochloride?
The IUPAC name of 6-(4-methoxyphenyl)-8-methyl-2,3-dihydroimidazo[1,2-b]pyridazine;hydrochloride (CID 24839118) is 6-(4-methoxyphenyl)-8-methyl-2,3-dihydroimidazo[1,2-b]pyridazine;hydrochloride.
What is the SMILES notation for 6-(4-methoxyphenyl)-8-methyl-2,3-dihydroimidazo[1,2-b]pyridazine;hydrochloride?
The canonical SMILES for 6-(4-methoxyphenyl)-8-methyl-2,3-dihydroimidazo[1,2-b]pyridazine;hydrochloride is COc1ccc(C2=NN3CCN=C3C(C)=C2)cc1.Cl.
What is the InChIKey of 6-(4-methoxyphenyl)-8-methyl-2,3-dihydroimidazo[1,2-b]pyridazine;hydrochloride?
The InChIKey is FEARIBWEEZCUQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O.ClH/c1-10-9-13(16-17-8-7-15-14(10)17)11-3-5-12(18-2)6-4-11;/h3-6,9H,7-8H2,1-2H3;1H.
What are the key properties of 6-(4-methoxyphenyl)-8-methyl-2,3-dihydroimidazo[1,2-b]pyridazine;hydrochloride?
6-(4-methoxyphenyl)-8-methyl-2,3-dihydroimidazo[1,2-b]pyridazine;hydrochloride has a molecular weight of 277.76 g/mol, XLogP of 2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-methoxyphenyl)-8-methyl-2,3-dihydroimidazo[1,2-b]pyridazine;hydrochloride is sourced from PubChem (CID 24839118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).