C31H52N2O — CID 24842198
(4E,8E,12E)-5,9,13,17-tetramethyl-1-[4-(3-methylbut-2-enyl)piperazin-1-yl]octadeca-4,8,12,16-tetraen-1-one (PubChem CID 24842198) has the molecular formula C31H52N2O and a molecular weight of 468.77 g/mol. Its IUPAC name is (4E,8E,12E)-5,9,13,17-tetramethyl-1-[4-(3-methylbut-2-enyl)piperazin-1-yl]octadeca-4,8,12,16-tetraen-1-one.
| Compound Name | (4E,8E,12E)-5,9,13,17-tetramethyl-1-[4-(3-methylbut-2-enyl)piperazin-1-yl]octadeca-4,8,12,16-tetraen-1-one |
|---|---|
| PubChem CID | 24842198 |
| Molecular Formula | C31H52N2O |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.41 |
| IUPAC Name | (4E,8E,12E)-5,9,13,17-tetramethyl-1-[4-(3-methylbut-2-enyl)piperazin-1-yl]octadeca-4,8,12,16-tetraen-1-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CCC(=O)N1CCN(CC=C(C)C)CC1 |
| InChI | InChI=1S/C31H52N2O/c1-26(2)12-8-13-28(5)14-9-15-29(6)16-10-17-30(7)18-11-19-31(34)33-24-22-32(23-25-33)21-20-27(3)4/h12,14,16,18,20H,8-11,13,15,17,19,21-25H2,1-7H3/b28-14+,29-16+,30-18+ |
| InChIKey | RBQPGJKFCKUTBB-VOOCPKKYSA-N |
| XLogP | 8.02 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|