C17H26Cl4N2 — CID 24847024
4-[bis(2-chloroethyl)aminomethyl]-3,5-bis(prop-2-enyl)aniline;dihydrochloride (PubChem CID 24847024) has the molecular formula C17H26Cl4N2 and a molecular weight of 400.22 g/mol. Its IUPAC name is 4-[bis(2-chloroethyl)aminomethyl]-3,5-bis(prop-2-enyl)aniline;dihydrochloride.
| Compound Name | 4-[bis(2-chloroethyl)aminomethyl]-3,5-bis(prop-2-enyl)aniline;dihydrochloride |
|---|---|
| PubChem CID | 24847024 |
| Molecular Formula | C17H26Cl4N2 |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 4-[bis(2-chloroethyl)aminomethyl]-3,5-bis(prop-2-enyl)aniline;dihydrochloride |
| SMILES | C=CCc1cc(N)cc(CC=C)c1CN(CCCl)CCCl.Cl.Cl |
| InChI | InChI=1S/C17H24Cl2N2.2ClH/c1-3-5-14-11-16(20)12-15(6-4-2)17(14)13-21(9-7-18)10-8-19;;/h3-4,11-12H,1-2,5-10,13,20H2;2*1H |
| InChIKey | JOYSBFANYMORFS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|