C15H18ClN — CID 24854600
7-chloro-1,5-dimethyl-2-pent-4-enylindole (PubChem CID 24854600) has the molecular formula C15H18ClN and a molecular weight of 247.77 g/mol. Its IUPAC name is 7-chloro-1,5-dimethyl-2-pent-4-enylindole.
| Compound Name | 7-chloro-1,5-dimethyl-2-pent-4-enylindole |
|---|---|
| PubChem CID | 24854600 |
| Molecular Formula | C15H18ClN |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 7-chloro-1,5-dimethyl-2-pent-4-enylindole |
| SMILES | C=CCCCc1cc2cc(C)cc(Cl)c2n1C |
| InChI | InChI=1S/C15H18ClN/c1-4-5-6-7-13-10-12-8-11(2)9-14(16)15(12)17(13)3/h4,8-10H,1,5-7H2,2-3H3 |
| InChIKey | ZWBDJDBQFFRPRX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|