C21H15N3O3S — CID 24857467
S-[4-[2-[3-[(2-oxo-1H-pyrimidin-6-yl)carbamoyl]phenyl]ethynyl]phenyl] ethanethioate (PubChem CID 24857467) has the molecular formula C21H15N3O3S and a molecular weight of 389.44 g/mol. Its IUPAC name is S-[4-[2-[3-[(2-oxo-1H-pyrimidin-6-yl)carbamoyl]phenyl]ethynyl]phenyl] ethanethioate.
| Compound Name | S-[4-[2-[3-[(2-oxo-1H-pyrimidin-6-yl)carbamoyl]phenyl]ethynyl]phenyl] ethanethioate |
|---|---|
| PubChem CID | 24857467 |
| Molecular Formula | C21H15N3O3S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | S-[4-[2-[3-[(2-oxo-1H-pyrimidin-6-yl)carbamoyl]phenyl]ethynyl]phenyl] ethanethioate |
| SMILES | CC(=O)Sc1ccc(C#Cc2cccc(C(=O)Nc3ccnc(=O)[nH]3)c2)cc1 |
| InChI | InChI=1S/C21H15N3O3S/c1-14(25)28-18-9-7-15(8-10-18)5-6-16-3-2-4-17(13-16)20(26)23-19-11-12-22-21(27)24-19/h2-4,7-13H,1H3,(H2,22,23,24,26,27) |
| InChIKey | MKPMFLKQZMNPQH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|