C12H16O4 — CID 24858892
(1R,5S)-3-formyl-5-hydroxy-1-(3-methylbut-2-enyl)cyclopent-2-ene-1-carboxylic acid (PubChem CID 24858892) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (1R,5S)-3-formyl-5-hydroxy-1-(3-methylbut-2-enyl)cyclopent-2-ene-1-carboxylic acid.
| Compound Name | (1R,5S)-3-formyl-5-hydroxy-1-(3-methylbut-2-enyl)cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 24858892 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (1R,5S)-3-formyl-5-hydroxy-1-(3-methylbut-2-enyl)cyclopent-2-ene-1-carboxylic acid |
| SMILES | CC(C)=CC[C@@]1(C(=O)O)C=C(C=O)C[C@@H]1O |
| InChI | InChI=1S/C12H16O4/c1-8(2)3-4-12(11(15)16)6-9(7-13)5-10(12)14/h3,6-7,10,14H,4-5H2,1-2H3,(H,15,16)/t10-,12+/m0/s1 |
| InChIKey | CSSWNGXGRIVQEO-CMPLNLGQSA-N |
| XLogP | 1.30 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|