C34H68O7Si — CID 24859896
tri(propan-2-yl)-[(6R,8S,9S,10R,11E,14R)-8,10,14-tris(methoxymethoxy)-9,12-dimethylheptadeca-1,11-dien-6-yl]oxysilane (PubChem CID 24859896) has the molecular formula C34H68O7Si and a molecular weight of 617.00 g/mol. Its IUPAC name is tri(propan-2-yl)-[(6R,8S,9S,10R,11E,14R)-8,10,14-tris(methoxymethoxy)-9,12-dimethylheptadeca-1,11-dien-6-yl]oxysilane.
| Compound Name | tri(propan-2-yl)-[(6R,8S,9S,10R,11E,14R)-8,10,14-tris(methoxymethoxy)-9,12-dimethylheptadeca-1,11-dien-6-yl]oxysilane |
|---|---|
| PubChem CID | 24859896 |
| Molecular Formula | C34H68O7Si |
| Molecular Weight | 617.00 g/mol |
| Exact Mass | 616.47 |
| IUPAC Name | tri(propan-2-yl)-[(6R,8S,9S,10R,11E,14R)-8,10,14-tris(methoxymethoxy)-9,12-dimethylheptadeca-1,11-dien-6-yl]oxysilane |
| SMILES | C=CCCC[C@H](C[C@H](OCOC)[C@H](C)[C@@H](/C=C(\C)C[C@@H](CCC)OCOC)OCOC)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C34H68O7Si/c1-14-16-17-19-32(41-42(26(3)4,27(5)6)28(7)8)22-34(40-25-37-13)30(10)33(39-24-36-12)21-29(9)20-31(18-15-2)38-23-35-11/h14,21,26-28,30-34H,1,15-20,22-25H2,2-13H3/b29-21+/t30-,31-,32-,33-,34+/m1/s1 |
| InChIKey | GSGWHUGWQNKLON-KEBQMIAWSA-N |
| XLogP | 9.03 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.00 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|