C31H62O7Si2 — CID 11753722
(2E,4R,5R,6S,8S,9E)-6,11-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxy-8-(2-methoxyethoxymethoxy)-3,5,9-trimethylundeca-2,9-dienal (PubChem CID 11753722) has the molecular formula C31H62O7Si2 and a molecular weight of 603.00 g/mol. Its IUPAC name is (2E,4R,5R,6S,8S,9E)-6,11-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxy-8-(2-methoxyethoxymethoxy)-3,5,9-trimethylundeca-2,9-dienal.
| Compound Name | (2E,4R,5R,6S,8S,9E)-6,11-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxy-8-(2-methoxyethoxymethoxy)-3,5,9-trimethylundeca-2,9-dienal |
|---|---|
| PubChem CID | 11753722 |
| Molecular Formula | C31H62O7Si2 |
| Molecular Weight | 603.00 g/mol |
| Exact Mass | 602.40 |
| IUPAC Name | (2E,4R,5R,6S,8S,9E)-6,11-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxy-8-(2-methoxyethoxymethoxy)-3,5,9-trimethylundeca-2,9-dienal |
| SMILES | COCCOCO[C@@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](OC)/C(C)=C/C=O)/C(C)=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H62O7Si2/c1-24(17-19-37-39(12,13)30(4,5)6)27(36-23-35-21-20-33-10)22-28(38-40(14,15)31(7,8)9)26(3)29(34-11)25(2)16-18-32/h16-18,26-29H,19-23H2,1-15H3/b24-17+,25-16+/t26-,27-,28-,29-/m0/s1 |
| InChIKey | HTRKYTHICXMARN-SJIMQGCPSA-N |
| XLogP | 7.54 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.00 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|