C13H20O — CID 24860028
[(E,1R)-1-prop-2-ynoxybut-2-enyl]cyclohexane (PubChem CID 24860028) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is [(E,1R)-1-prop-2-ynoxybut-2-enyl]cyclohexane.
| Compound Name | [(E,1R)-1-prop-2-ynoxybut-2-enyl]cyclohexane |
|---|---|
| PubChem CID | 24860028 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | [(E,1R)-1-prop-2-ynoxybut-2-enyl]cyclohexane |
| SMILES | C#CCO[C@@H](/C=C/C)C1CCCCC1 |
| InChI | InChI=1S/C13H20O/c1-3-8-13(14-11-4-2)12-9-6-5-7-10-12/h2-3,8,12-13H,5-7,9-11H2,1H3/b8-3+/t13-/m0/s1 |
| InChIKey | JDAXYJNAPYAUOK-UTPRNQHHSA-N |
| XLogP | 3.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|