C31H28N2OS — CID 24860948
N-(1H-indol-5-ylmethyl)-3-tritylsulfanylpropanamide (PubChem CID 24860948) has the molecular formula C31H28N2OS and a molecular weight of 476.65 g/mol. Its IUPAC name is N-(1H-indol-5-ylmethyl)-3-tritylsulfanylpropanamide.
| Compound Name | N-(1H-indol-5-ylmethyl)-3-tritylsulfanylpropanamide |
|---|---|
| PubChem CID | 24860948 |
| Molecular Formula | C31H28N2OS |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | N-(1H-indol-5-ylmethyl)-3-tritylsulfanylpropanamide |
| SMILES | O=C(CCSC(c1ccccc1)(c1ccccc1)c1ccccc1)NCc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C31H28N2OS/c34-30(33-23-24-16-17-29-25(22-24)18-20-32-29)19-21-35-31(26-10-4-1-5-11-26,27-12-6-2-7-13-27)28-14-8-3-9-15-28/h1-18,20,22,32H,19,21,23H2,(H,33,34) |
| InChIKey | PGUNHXHHURQTDY-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|