C18H26F3N — CID 24862408
(E)-N,N-dibutyl-1,1,1-trifluoro-4-phenylbut-3-en-2-amine (PubChem CID 24862408) has the molecular formula C18H26F3N and a molecular weight of 313.41 g/mol. Its IUPAC name is (E)-N,N-dibutyl-1,1,1-trifluoro-4-phenylbut-3-en-2-amine.
| Compound Name | (E)-N,N-dibutyl-1,1,1-trifluoro-4-phenylbut-3-en-2-amine |
|---|---|
| PubChem CID | 24862408 |
| Molecular Formula | C18H26F3N |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (E)-N,N-dibutyl-1,1,1-trifluoro-4-phenylbut-3-en-2-amine |
| SMILES | CCCCN(CCCC)C(/C=C/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H26F3N/c1-3-5-14-22(15-6-4-2)17(18(19,20)21)13-12-16-10-8-7-9-11-16/h7-13,17H,3-6,14-15H2,1-2H3/b13-12+ |
| InChIKey | QYGXOTCDGGEFEF-OUKQBFOZSA-N |
| XLogP | 5.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |