C32H49NO6 — CID 24878419
N-[(3aR,5S,6R,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-2-[4-(4-hexylcyclohexyl)phenyl]acetamide (PubChem CID 24878419) has the molecular formula C32H49NO6 and a molecular weight of 543.75 g/mol. Its IUPAC name is N-[(3aR,5S,6R,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-2-[4-(4-hexylcyclohexyl)phenyl]acetamide.
| Compound Name | N-[(3aR,5S,6R,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-2-[4-(4-hexylcyclohexyl)phenyl]acetamide |
|---|---|
| PubChem CID | 24878419 |
| Molecular Formula | C32H49NO6 |
| Molecular Weight | 543.75 g/mol |
| Exact Mass | 543.36 |
| IUPAC Name | N-[(3aR,5S,6R,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-2-[4-(4-hexylcyclohexyl)phenyl]acetamide |
| SMILES | CCCCCCC1CCC(c2ccc(CC(=O)N[C@H]3[C@H]4OC(C)(C)O[C@H]4O[C@@H]3C3COC(C)(C)O3)cc2)CC1 |
| InChI | InChI=1S/C32H49NO6/c1-6-7-8-9-10-21-11-15-23(16-12-21)24-17-13-22(14-18-24)19-26(34)33-27-28(25-20-35-31(2,3)37-25)36-30-29(27)38-32(4,5)39-30/h13-14,17-18,21,23,25,27-30H,6-12,15-16,19-20H2,1-5H3,(H,33,34)/t21?,23?,25?,27-,28-,29-,30-/m1/s1 |
| InChIKey | OHXYEPBDMJABBN-PHYLRLGDSA-N |
| XLogP | 5.99 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.75 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|