C23H21N2O5PS — CID 24878802
2-(3-ethoxy-4-hydroxyphenyl)-3-(10-hydroxy-10-oxo-5H-phenophosphazinin-2-yl)-1,3-thiazolidin-4-one (PubChem CID 24878802) has the molecular formula C23H21N2O5PS and a molecular weight of 468.47 g/mol. Its IUPAC name is 2-(3-ethoxy-4-hydroxyphenyl)-3-(10-hydroxy-10-oxo-5H-phenophosphazinin-2-yl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(3-ethoxy-4-hydroxyphenyl)-3-(10-hydroxy-10-oxo-5H-phenophosphazinin-2-yl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 24878802 |
| Molecular Formula | C23H21N2O5PS |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 2-(3-ethoxy-4-hydroxyphenyl)-3-(10-hydroxy-10-oxo-5H-phenophosphazinin-2-yl)-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(C2SCC(=O)N2c2ccc3c(c2)P(=O)(O)c2ccccc2N3)ccc1O |
| InChI | InChI=1S/C23H21N2O5PS/c1-2-30-19-11-14(7-10-18(19)26)23-25(22(27)13-32-23)15-8-9-17-21(12-15)31(28,29)20-6-4-3-5-16(20)24-17/h3-12,23-24,26H,2,13H2,1H3,(H,28,29) |
| InChIKey | ZOQCZXZZAZPSHY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|