C25H33N3OS — CID 24891775
N-butyl-2-(3-cyclohexylsulfanyl-4-methoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine (PubChem CID 24891775) has the molecular formula C25H33N3OS and a molecular weight of 423.63 g/mol. Its IUPAC name is N-butyl-2-(3-cyclohexylsulfanyl-4-methoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine.
| Compound Name | N-butyl-2-(3-cyclohexylsulfanyl-4-methoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 24891775 |
| Molecular Formula | C25H33N3OS |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | N-butyl-2-(3-cyclohexylsulfanyl-4-methoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine |
| SMILES | CCCCNc1c(-c2ccc(OC)c(SC3CCCCC3)c2)nc2cc(C)ccn12 |
| InChI | InChI=1S/C25H33N3OS/c1-4-5-14-26-25-24(27-23-16-18(2)13-15-28(23)25)19-11-12-21(29-3)22(17-19)30-20-9-7-6-8-10-20/h11-13,15-17,20,26H,4-10,14H2,1-3H3 |
| InChIKey | USMHUWBUXKQKFV-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|