C24H15F3N2O — CID 24899468
4-[1-[3-[(4-cyanophenoxy)methyl]phenyl]ethenyl]-2-(trifluoromethyl)benzonitrile (PubChem CID 24899468) has the molecular formula C24H15F3N2O and a molecular weight of 404.39 g/mol. Its IUPAC name is 4-[1-[3-[(4-cyanophenoxy)methyl]phenyl]ethenyl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[1-[3-[(4-cyanophenoxy)methyl]phenyl]ethenyl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 24899468 |
| Molecular Formula | C24H15F3N2O |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 4-[1-[3-[(4-cyanophenoxy)methyl]phenyl]ethenyl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C=C(c1cccc(COc2ccc(C#N)cc2)c1)c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H15F3N2O/c1-16(20-7-8-21(14-29)23(12-20)24(25,26)27)19-4-2-3-18(11-19)15-30-22-9-5-17(13-28)6-10-22/h2-12H,1,15H2 |
| InChIKey | GLQDXLSYKJGKQC-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |