C30H25F3N4O3 — CID 2490153
[2-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-oxoethyl] (E)-2-cyano-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate (PubChem CID 2490153) has the molecular formula C30H25F3N4O3 and a molecular weight of 546.55 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-oxoethyl] (E)-2-cyano-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-oxoethyl] (E)-2-cyano-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2490153 |
| Molecular Formula | C30H25F3N4O3 |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | [2-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-oxoethyl] (E)-2-cyano-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=C(\C#N)C(=O)OCC(=O)c1cc(C)n(-c2cccc(C(F)(F)F)c2)c1C |
| InChI | InChI=1S/C30H25F3N4O3/c1-18-13-27(20(3)36(18)25-12-8-9-23(15-25)30(31,32)33)28(38)17-40-29(39)22(16-34)14-26-19(2)35-37(21(26)4)24-10-6-5-7-11-24/h5-15H,17H2,1-4H3/b22-14+ |
| InChIKey | PZKILEBNUPMECZ-HYARGMPZSA-N |
| XLogP | 6.25 |
| TPSA | 89.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|