C14H26MgN4O4S6 — CID 24940438
magnesium bis(N-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]carbamodithioate) (PubChem CID 24940438) has the molecular formula C14H26MgN4O4S6 and a molecular weight of 531.09 g/mol. Its IUPAC name is magnesium bis(N-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]carbamodithioate).
| Compound Name | magnesium bis(N-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]carbamodithioate) |
|---|---|
| PubChem CID | 24940438 |
| Molecular Formula | C14H26MgN4O4S6 |
| Molecular Weight | 531.09 g/mol |
| Exact Mass | 530.01 |
| IUPAC Name | magnesium bis(N-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]carbamodithioate) |
| SMILES | O=S1(=O)CCC(NCCNC(=S)[S-])C1.O=S1(=O)CCC(NCCNC(=S)[S-])C1.[Mg+2] |
| InChI | InChI=1S/2C7H14N2O2S3.Mg/c2*10-14(11)4-1-6(5-14)8-2-3-9-7(12)13;/h2*6,8H,1-5H2,(H2,9,12,13);/q;;+2/p-2 |
| InChIKey | RDQHAXSNCACNLP-UHFFFAOYSA-L |
| XLogP | -2.01 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.09 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|