C14H26CuN4O6S6 — CID 24940440
copper bis(N-[2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]ethyl]carbamodithioate) (PubChem CID 24940440) has the molecular formula C14H26CuN4O6S6 and a molecular weight of 602.33 g/mol. Its IUPAC name is copper bis(N-[2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]ethyl]carbamodithioate).
| Compound Name | copper bis(N-[2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]ethyl]carbamodithioate) |
|---|---|
| PubChem CID | 24940440 |
| Molecular Formula | C14H26CuN4O6S6 |
| Molecular Weight | 602.33 g/mol |
| Exact Mass | 600.95 |
| IUPAC Name | copper bis(N-[2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]ethyl]carbamodithioate) |
| SMILES | O=S1(=O)CC(O)C(NCCNC(=S)[S-])C1.O=S1(=O)CC(O)C(NCCNC(=S)[S-])C1.[Cu+2] |
| InChI | InChI=1S/2C7H14N2O3S3.Cu/c2*10-6-4-15(11,12)3-5(6)8-1-2-9-7(13)14;/h2*5-6,8,10H,1-4H2,(H2,9,13,14);/q;;+2/p-2 |
| InChIKey | APDZXGHIPOMWIU-UHFFFAOYSA-L |
| XLogP | -3.69 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.33 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|