C18H19FIN5O2 — CID 24967884
3-[2-(dimethylamino)ethyl]-5-(2-fluoro-4-iodoanilino)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 24967884) has the molecular formula C18H19FIN5O2 and a molecular weight of 483.29 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-5-(2-fluoro-4-iodoanilino)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 3-[2-(dimethylamino)ethyl]-5-(2-fluoro-4-iodoanilino)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 24967884 |
| Molecular Formula | C18H19FIN5O2 |
| Molecular Weight | 483.29 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-5-(2-fluoro-4-iodoanilino)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | CN(C)CCn1cnc2c(c(Nc3ccc(I)cc3F)cc(=O)n2C)c1=O |
| InChI | InChI=1S/C18H19FIN5O2/c1-23(2)6-7-25-10-21-17-16(18(25)27)14(9-15(26)24(17)3)22-13-5-4-11(20)8-12(13)19/h4-5,8-10,22H,6-7H2,1-3H3 |
| InChIKey | NGAGTHBIDDBJIY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|