C23H30O5Si — CID 24971005
6-[tert-butyl(dimethyl)silyl]-4-(2-methyl-1,3-dioxolan-2-yl)-3-phenylmethoxycyclohexa-3,5-diene-1,2-dione (PubChem CID 24971005) has the molecular formula C23H30O5Si and a molecular weight of 414.57 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]-4-(2-methyl-1,3-dioxolan-2-yl)-3-phenylmethoxycyclohexa-3,5-diene-1,2-dione.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]-4-(2-methyl-1,3-dioxolan-2-yl)-3-phenylmethoxycyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 24971005 |
| Molecular Formula | C23H30O5Si |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]-4-(2-methyl-1,3-dioxolan-2-yl)-3-phenylmethoxycyclohexa-3,5-diene-1,2-dione |
| SMILES | CC1(C2=C(OCc3ccccc3)C(=O)C(=O)C([Si](C)(C)C(C)(C)C)=C2)OCCO1 |
| InChI | InChI=1S/C23H30O5Si/c1-22(2,3)29(5,6)18-14-17(23(4)27-12-13-28-23)21(20(25)19(18)24)26-15-16-10-8-7-9-11-16/h7-11,14H,12-13,15H2,1-6H3 |
| InChIKey | MTXVSRPOTMFVBG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|