C13H23NO — CID 24972041
1-(6,10-dimethyl-1-azaspiro[4.5]decan-3-yl)ethanone (PubChem CID 24972041) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 1-(6,10-dimethyl-1-azaspiro[4.5]decan-3-yl)ethanone.
| Compound Name | 1-(6,10-dimethyl-1-azaspiro[4.5]decan-3-yl)ethanone |
|---|---|
| PubChem CID | 24972041 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 1-(6,10-dimethyl-1-azaspiro[4.5]decan-3-yl)ethanone |
| SMILES | CC(=O)C1CNC2(C1)C(C)CCCC2C |
| InChI | InChI=1S/C13H23NO/c1-9-5-4-6-10(2)13(9)7-12(8-14-13)11(3)15/h9-10,12,14H,4-8H2,1-3H3 |
| InChIKey | VZKYKKRDSCGLFE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |