C19H34O2 — CID 24972525
2-[(E)-1-cyclohexyloct-1-en-3-yl]oxyoxane (PubChem CID 24972525) has the molecular formula C19H34O2 and a molecular weight of 294.48 g/mol. Its IUPAC name is 2-[(E)-1-cyclohexyloct-1-en-3-yl]oxyoxane.
| Compound Name | 2-[(E)-1-cyclohexyloct-1-en-3-yl]oxyoxane |
|---|---|
| PubChem CID | 24972525 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | 2-[(E)-1-cyclohexyloct-1-en-3-yl]oxyoxane |
| SMILES | CCCCCC(/C=C/C1CCCCC1)OC1CCCCO1 |
| InChI | InChI=1S/C19H34O2/c1-2-3-5-12-18(21-19-13-8-9-16-20-19)15-14-17-10-6-4-7-11-17/h14-15,17-19H,2-13,16H2,1H3/b15-14+ |
| InChIKey | ZCKQQXUNDXUKAH-CCEZHUSRSA-N |
| XLogP | 5.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|