C20H19ClN2O3 — CID 24985654
(12R)-5-chloro-10-ethenyl-10-methoxy-4-methyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-ol (PubChem CID 24985654) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is (12R)-5-chloro-10-ethenyl-10-methoxy-4-methyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-ol.
| Compound Name | (12R)-5-chloro-10-ethenyl-10-methoxy-4-methyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-ol |
|---|---|
| PubChem CID | 24985654 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (12R)-5-chloro-10-ethenyl-10-methoxy-4-methyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-ol |
| SMILES | C=CC1(OC)c2ccn3c(Cl)c(C)nc3c2O[C@H](c2ccccc2)C1O |
| InChI | InChI=1S/C20H19ClN2O3/c1-4-20(25-3)14-10-11-23-18(21)12(2)22-19(23)16(14)26-15(17(20)24)13-8-6-5-7-9-13/h4-11,15,17,24H,1H2,2-3H3/t15-,17?,20?/m1/s1 |
| InChIKey | UQJNCUFPXDVGKZ-XRTORIHISA-N |
| XLogP | 3.82 |
| TPSA | 55.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|