C17H20IN3O4 — CID 24994556
2-(2-hydroxyethylamino)-4-(3-iodo-4,5-dimethoxyanilino)benzamide (PubChem CID 24994556) has the molecular formula C17H20IN3O4 and a molecular weight of 457.27 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)-4-(3-iodo-4,5-dimethoxyanilino)benzamide.
| Compound Name | 2-(2-hydroxyethylamino)-4-(3-iodo-4,5-dimethoxyanilino)benzamide |
|---|---|
| PubChem CID | 24994556 |
| Molecular Formula | C17H20IN3O4 |
| Molecular Weight | 457.27 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | 2-(2-hydroxyethylamino)-4-(3-iodo-4,5-dimethoxyanilino)benzamide |
| SMILES | COc1cc(Nc2ccc(C(N)=O)c(NCCO)c2)cc(I)c1OC |
| InChI | InChI=1S/C17H20IN3O4/c1-24-15-9-11(7-13(18)16(15)25-2)21-10-3-4-12(17(19)23)14(8-10)20-5-6-22/h3-4,7-9,20-22H,5-6H2,1-2H3,(H2,19,23) |
| InChIKey | CMOMYIVTKSMHAD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|