C28H26ClN7 — CID 25003241
7-chloro-2-ethyl-5-methyl-3-[[(2E)-2-[1-(2H-tetrazol-5-yl)ethylidene]-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]imidazo[4,5-b]pyridine (PubChem CID 25003241) has the molecular formula C28H26ClN7 and a molecular weight of 496.02 g/mol. Its IUPAC name is 7-chloro-2-ethyl-5-methyl-3-[[(2E)-2-[1-(2H-tetrazol-5-yl)ethylidene]-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]imidazo[4,5-b]pyridine.
| Compound Name | 7-chloro-2-ethyl-5-methyl-3-[[(2E)-2-[1-(2H-tetrazol-5-yl)ethylidene]-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 25003241 |
| Molecular Formula | C28H26ClN7 |
| Molecular Weight | 496.02 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 7-chloro-2-ethyl-5-methyl-3-[[(2E)-2-[1-(2H-tetrazol-5-yl)ethylidene]-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]imidazo[4,5-b]pyridine |
| SMILES | CCc1nc2c(Cl)cc(C)nc2n1Cc1ccc2c(c1)CCc1ccccc1/C2=C(/C)c1nn[nH]n1 |
| InChI | InChI=1S/C28H26ClN7/c1-4-24-31-26-23(29)13-16(2)30-28(26)36(24)15-18-9-12-22-20(14-18)11-10-19-7-5-6-8-21(19)25(22)17(3)27-32-34-35-33-27/h5-9,12-14H,4,10-11,15H2,1-3H3,(H,32,33,34,35)/b25-17+ |
| InChIKey | CSRRXZOGFFKPHD-KOEQRZSOSA-N |
| XLogP | 5.59 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.02 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|