C28H27N7 — CID 69015723
2-ethyl-7-methyl-3-[[2-[1-(2H-tetrazol-5-yl)ethylidene]-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]imidazo[4,5-b]pyridine (PubChem CID 69015723) has the molecular formula C28H27N7 and a molecular weight of 461.57 g/mol. Its IUPAC name is 2-ethyl-7-methyl-3-[[2-[1-(2H-tetrazol-5-yl)ethylidene]-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]imidazo[4,5-b]pyridine.
| Compound Name | 2-ethyl-7-methyl-3-[[2-[1-(2H-tetrazol-5-yl)ethylidene]-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 69015723 |
| Molecular Formula | C28H27N7 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 2-ethyl-7-methyl-3-[[2-[1-(2H-tetrazol-5-yl)ethylidene]-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]imidazo[4,5-b]pyridine |
| SMILES | CCc1nc2c(C)ccnc2n1Cc1ccc2c(c1)CCc1ccccc1C2=C(C)c1nn[nH]n1 |
| InChI | InChI=1S/C28H27N7/c1-4-24-30-26-17(2)13-14-29-28(26)35(24)16-19-9-12-23-21(15-19)11-10-20-7-5-6-8-22(20)25(23)18(3)27-31-33-34-32-27/h5-9,12-15H,4,10-11,16H2,1-3H3,(H,31,32,33,34) |
| InChIKey | HASRIDQSRUZGGX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|