C22H20INO2 — CID 2501574
2-ethoxy-N-(4-iodophenyl)-2,2-diphenylacetamide (PubChem CID 2501574) has the molecular formula C22H20INO2 and a molecular weight of 457.31 g/mol. Its IUPAC name is 2-ethoxy-N-(4-iodophenyl)-2,2-diphenylacetamide.
| Compound Name | 2-ethoxy-N-(4-iodophenyl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 2501574 |
| Molecular Formula | C22H20INO2 |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | 2-ethoxy-N-(4-iodophenyl)-2,2-diphenylacetamide |
| SMILES | CCOC(C(=O)Nc1ccc(I)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20INO2/c1-2-26-22(17-9-5-3-6-10-17,18-11-7-4-8-12-18)21(25)24-20-15-13-19(23)14-16-20/h3-16H,2H2,1H3,(H,24,25) |
| InChIKey | JSKSWIPRGLHKGD-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|