C25H24F2N8O — CID 25019946
10-[(E)-4-[4-(2,4-difluorophenyl)piperazin-1-yl]but-2-enyl]-4-(furan-2-yl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine (PubChem CID 25019946) has the molecular formula C25H24F2N8O and a molecular weight of 490.52 g/mol. Its IUPAC name is 10-[(E)-4-[4-(2,4-difluorophenyl)piperazin-1-yl]but-2-enyl]-4-(furan-2-yl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine.
| Compound Name | 10-[(E)-4-[4-(2,4-difluorophenyl)piperazin-1-yl]but-2-enyl]-4-(furan-2-yl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
|---|---|
| PubChem CID | 25019946 |
| Molecular Formula | C25H24F2N8O |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 10-[(E)-4-[4-(2,4-difluorophenyl)piperazin-1-yl]but-2-enyl]-4-(furan-2-yl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
| SMILES | Nc1nc2c(ccn2C/C=C/CN2CCN(c3ccc(F)cc3F)CC2)c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C25H24F2N8O/c26-17-5-6-20(19(27)16-17)33-13-11-32(12-14-33)8-1-2-9-34-10-7-18-23(34)30-25(28)35-24(18)29-22(31-35)21-4-3-15-36-21/h1-7,10,15-16H,8-9,11-14H2,(H2,28,30)/b2-1+ |
| InChIKey | SUXJAEXJMDFYGV-OWOJBTEDSA-N |
| XLogP | 3.58 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|