C23H24F2N8O — CID 25029201
N'-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]-N'-(2,4-difluorophenyl)butane-1,4-diamine (PubChem CID 25029201) has the molecular formula C23H24F2N8O and a molecular weight of 466.50 g/mol. Its IUPAC name is N'-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]-N'-(2,4-difluorophenyl)butane-1,4-diamine.
| Compound Name | N'-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]-N'-(2,4-difluorophenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 25029201 |
| Molecular Formula | C23H24F2N8O |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N'-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]-N'-(2,4-difluorophenyl)butane-1,4-diamine |
| SMILES | NCCCCN(CCn1ccc2c1nc(N)n1nc(-c3ccco3)nc21)c1ccc(F)cc1F |
| InChI | InChI=1S/C23H24F2N8O/c24-15-5-6-18(17(25)14-15)31(9-2-1-8-26)11-12-32-10-7-16-21(32)29-23(27)33-22(16)28-20(30-33)19-4-3-13-34-19/h3-7,10,13-14H,1-2,8-9,11-12,26H2,(H2,27,29) |
| InChIKey | DJHRRLNLCVCIHC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|