C28H32O5 — CID 25023352
[3-hydroxy-5-methoxy-2-[(1R,6R)-4-(4-methylpent-3-enyl)-6-phenylcyclohex-3-ene-1-carbonyl]phenyl] acetate (PubChem CID 25023352) has the molecular formula C28H32O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is [3-hydroxy-5-methoxy-2-[(1R,6R)-4-(4-methylpent-3-enyl)-6-phenylcyclohex-3-ene-1-carbonyl]phenyl] acetate.
| Compound Name | [3-hydroxy-5-methoxy-2-[(1R,6R)-4-(4-methylpent-3-enyl)-6-phenylcyclohex-3-ene-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 25023352 |
| Molecular Formula | C28H32O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | [3-hydroxy-5-methoxy-2-[(1R,6R)-4-(4-methylpent-3-enyl)-6-phenylcyclohex-3-ene-1-carbonyl]phenyl] acetate |
| SMILES | COc1cc(O)c(C(=O)[C@@H]2CC=C(CCC=C(C)C)C[C@H]2c2ccccc2)c(OC(C)=O)c1 |
| InChI | InChI=1S/C28H32O5/c1-18(2)9-8-10-20-13-14-23(24(15-20)21-11-6-5-7-12-21)28(31)27-25(30)16-22(32-4)17-26(27)33-19(3)29/h5-7,9,11-13,16-17,23-24,30H,8,10,14-15H2,1-4H3/t23-,24+/m1/s1 |
| InChIKey | KLNBAZGISKMTMT-RPWUZVMVSA-N |
| XLogP | 6.38 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|