C19H16FN3OS — CID 25024191
1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-(2-phenylcyclopropyl)urea (PubChem CID 25024191) has the molecular formula C19H16FN3OS and a molecular weight of 353.42 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-(2-phenylcyclopropyl)urea.
| Compound Name | 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-(2-phenylcyclopropyl)urea |
|---|---|
| PubChem CID | 25024191 |
| Molecular Formula | C19H16FN3OS |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-(2-phenylcyclopropyl)urea |
| SMILES | O=C(Nc1nc(-c2ccc(F)cc2)cs1)NC1CC1c1ccccc1 |
| InChI | InChI=1S/C19H16FN3OS/c20-14-8-6-13(7-9-14)17-11-25-19(22-17)23-18(24)21-16-10-15(16)12-4-2-1-3-5-12/h1-9,11,15-16H,10H2,(H2,21,22,23,24) |
| InChIKey | IOBDYQNYKGPXDW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |