C10H13N2O9P — CID 25026899
[(2R,3S,5R)-5-(6-formyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 25026899) has the molecular formula C10H13N2O9P and a molecular weight of 336.19 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-formyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(6-formyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 25026899 |
| Molecular Formula | C10H13N2O9P |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | [(2R,3S,5R)-5-(6-formyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=Cc1cc(=O)[nH]c(=O)n1[C@H]1C[C@H](O)[C@@H](COP(=O)(O)O)O1 |
| InChI | InChI=1S/C10H13N2O9P/c13-3-5-1-8(15)11-10(16)12(5)9-2-6(14)7(21-9)4-20-22(17,18)19/h1,3,6-7,9,14H,2,4H2,(H,11,15,16)(H2,17,18,19)/t6-,7+,9+/m0/s1 |
| InChIKey | BKHVVABXFRTEAQ-LKEWCRSYSA-N |
| XLogP | -1.89 |
| TPSA | 168.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|