C11H9ClN4O7S2 — CID 25040148
6-chloro-3-(5-nitrofuran-2-yl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide (PubChem CID 25040148) has the molecular formula C11H9ClN4O7S2 and a molecular weight of 408.80 g/mol. Its IUPAC name is 6-chloro-3-(5-nitrofuran-2-yl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide.
| Compound Name | 6-chloro-3-(5-nitrofuran-2-yl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
|---|---|
| PubChem CID | 25040148 |
| Molecular Formula | C11H9ClN4O7S2 |
| Molecular Weight | 408.80 g/mol |
| Exact Mass | 407.96 |
| IUPAC Name | 6-chloro-3-(5-nitrofuran-2-yl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
| SMILES | NS(=O)(=O)c1cc2c(cc1Cl)NC(c1ccc([N+](=O)[O-])o1)NS2(=O)=O |
| InChI | InChI=1S/C11H9ClN4O7S2/c12-5-3-6-9(4-8(5)24(13,19)20)25(21,22)15-11(14-6)7-1-2-10(23-7)16(17)18/h1-4,11,14-15H,(H2,13,19,20) |
| InChIKey | WSPCTZINAWSWGN-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 174.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.80 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|