C14H13N3O2S2 — CID 25049703
N-[2-(2,1,3-benzothiadiazol-4-yl)ethyl]benzenesulfonamide (PubChem CID 25049703) has the molecular formula C14H13N3O2S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is N-[2-(2,1,3-benzothiadiazol-4-yl)ethyl]benzenesulfonamide.
| Compound Name | N-[2-(2,1,3-benzothiadiazol-4-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25049703 |
| Molecular Formula | C14H13N3O2S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | N-[2-(2,1,3-benzothiadiazol-4-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCc1cccc2nsnc12)c1ccccc1 |
| InChI | InChI=1S/C14H13N3O2S2/c18-21(19,12-6-2-1-3-7-12)15-10-9-11-5-4-8-13-14(11)17-20-16-13/h1-8,15H,9-10H2 |
| InChIKey | SLTPUDQUTBBDPC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |