C17H22N6O — CID 25055211
1-cyano-3-(4-ethoxyphenyl)-2-[3-(4-methylimidazol-1-yl)propyl]guanidine (PubChem CID 25055211) has the molecular formula C17H22N6O and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-cyano-3-(4-ethoxyphenyl)-2-[3-(4-methylimidazol-1-yl)propyl]guanidine.
| Compound Name | 1-cyano-3-(4-ethoxyphenyl)-2-[3-(4-methylimidazol-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 25055211 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 1-cyano-3-(4-ethoxyphenyl)-2-[3-(4-methylimidazol-1-yl)propyl]guanidine |
| SMILES | CCOc1ccc(N/C(=N/CCCn2cnc(C)c2)NC#N)cc1 |
| InChI | InChI=1S/C17H22N6O/c1-3-24-16-7-5-15(6-8-16)22-17(20-12-18)19-9-4-10-23-11-14(2)21-13-23/h5-8,11,13H,3-4,9-10H2,1-2H3,(H2,19,20,22) |
| InChIKey | DUBYSFAYIHVAIB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 87.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|