C20H42O2Si2 — CID 25067662
tert-butyl-dimethyl-[(2E)-4-tri(propan-2-yl)silyloxypenta-2,4-dienoxy]silane (PubChem CID 25067662) has the molecular formula C20H42O2Si2 and a molecular weight of 370.73 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2E)-4-tri(propan-2-yl)silyloxypenta-2,4-dienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2E)-4-tri(propan-2-yl)silyloxypenta-2,4-dienoxy]silane |
|---|---|
| PubChem CID | 25067662 |
| Molecular Formula | C20H42O2Si2 |
| Molecular Weight | 370.73 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | tert-butyl-dimethyl-[(2E)-4-tri(propan-2-yl)silyloxypenta-2,4-dienoxy]silane |
| SMILES | C=C(/C=C/CO[Si](C)(C)C(C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H42O2Si2/c1-16(2)24(17(3)4,18(5)6)22-19(7)14-13-15-21-23(11,12)20(8,9)10/h13-14,16-18H,7,15H2,1-6,8-12H3/b14-13+ |
| InChIKey | CFGPNRSZATVUTD-BUHFOSPRSA-N |
| XLogP | 7.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.73 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|