C17H18N6O2S2 — CID 25093446
12-methyl-8-(methylamino)-4-[3-[(sulfamoylamino)methyl]phenyl]-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 25093446) has the molecular formula C17H18N6O2S2 and a molecular weight of 402.51 g/mol. Its IUPAC name is 12-methyl-8-(methylamino)-4-[3-[(sulfamoylamino)methyl]phenyl]-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 12-methyl-8-(methylamino)-4-[3-[(sulfamoylamino)methyl]phenyl]-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 25093446 |
| Molecular Formula | C17H18N6O2S2 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 12-methyl-8-(methylamino)-4-[3-[(sulfamoylamino)methyl]phenyl]-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | CNc1nc2cc(-c3cccc(CNS(N)(=O)=O)c3)sc2n2c(C)cnc12 |
| InChI | InChI=1S/C17H18N6O2S2/c1-10-8-20-16-15(19-2)22-13-7-14(26-17(13)23(10)16)12-5-3-4-11(6-12)9-21-27(18,24)25/h3-8,21H,9H2,1-2H3,(H,19,22)(H2,18,24,25) |
| InChIKey | ZFUNSBXCLHVTOY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 114.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |