C12H10BrNO5 — CID 25100366
2-(6-bromo-2-formamido-1-hydroxy-3-oxo-1H-inden-2-yl)acetic acid (PubChem CID 25100366) has the molecular formula C12H10BrNO5 and a molecular weight of 328.12 g/mol. Its IUPAC name is 2-(6-bromo-2-formamido-1-hydroxy-3-oxo-1H-inden-2-yl)acetic acid.
| Compound Name | 2-(6-bromo-2-formamido-1-hydroxy-3-oxo-1H-inden-2-yl)acetic acid |
|---|---|
| PubChem CID | 25100366 |
| Molecular Formula | C12H10BrNO5 |
| Molecular Weight | 328.12 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 2-(6-bromo-2-formamido-1-hydroxy-3-oxo-1H-inden-2-yl)acetic acid |
| SMILES | O=CNC1(CC(=O)O)C(=O)c2ccc(Br)cc2C1O |
| InChI | InChI=1S/C12H10BrNO5/c13-6-1-2-7-8(3-6)11(19)12(10(7)18,14-5-15)4-9(16)17/h1-3,5,11,19H,4H2,(H,14,15)(H,16,17) |
| InChIKey | DJCIPFSMQLJCME-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.12 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|