C13H16O2S3 — CID 25104775
3,3-bis(methylsulfanyl)-2-(methylsulfinylmethyl)-1-phenylprop-2-en-1-one (PubChem CID 25104775) has the molecular formula C13H16O2S3 and a molecular weight of 300.47 g/mol. Its IUPAC name is 3,3-bis(methylsulfanyl)-2-(methylsulfinylmethyl)-1-phenylprop-2-en-1-one.
| Compound Name | 3,3-bis(methylsulfanyl)-2-(methylsulfinylmethyl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 25104775 |
| Molecular Formula | C13H16O2S3 |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 3,3-bis(methylsulfanyl)-2-(methylsulfinylmethyl)-1-phenylprop-2-en-1-one |
| SMILES | CSC(SC)=C(CS(C)=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16O2S3/c1-16-13(17-2)11(9-18(3)15)12(14)10-7-5-4-6-8-10/h4-8H,9H2,1-3H3 |
| InChIKey | CEIIQJHLPFRFBP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|