C21H32OSi — CID 25105525
tert-butyl-[(1S,8R)-8-butyl-5-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-3-yl]-dimethylsilane (PubChem CID 25105525) has the molecular formula C21H32OSi and a molecular weight of 328.57 g/mol. Its IUPAC name is tert-butyl-[(1S,8R)-8-butyl-5-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-3-yl]-dimethylsilane.
| Compound Name | tert-butyl-[(1S,8R)-8-butyl-5-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-3-yl]-dimethylsilane |
|---|---|
| PubChem CID | 25105525 |
| Molecular Formula | C21H32OSi |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | tert-butyl-[(1S,8R)-8-butyl-5-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-3-yl]-dimethylsilane |
| SMILES | CCCC[C@]12C=C[C@H](O1)c1c2cc(C)cc1[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H32OSi/c1-8-9-11-21-12-10-17(22-21)19-16(21)13-15(2)14-18(19)23(6,7)20(3,4)5/h10,12-14,17H,8-9,11H2,1-7H3/t17-,21+/m0/s1 |
| InChIKey | OBWKTVVFDHWAKH-LAUBAEHRSA-N |
| XLogP | 5.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|