C10H12N6O3S2 — CID 25105605
4-[5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazol-2-yl]-1,4-thiazinane 1-oxide (PubChem CID 25105605) has the molecular formula C10H12N6O3S2 and a molecular weight of 328.38 g/mol. Its IUPAC name is 4-[5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazol-2-yl]-1,4-thiazinane 1-oxide.
| Compound Name | 4-[5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazol-2-yl]-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 25105605 |
| Molecular Formula | C10H12N6O3S2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 4-[5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazol-2-yl]-1,4-thiazinane 1-oxide |
| SMILES | Cn1c([N+](=O)[O-])cnc1-c1nnc(N2CCS(=O)CC2)s1 |
| InChI | InChI=1S/C10H12N6O3S2/c1-14-7(16(17)18)6-11-8(14)9-12-13-10(20-9)15-2-4-21(19)5-3-15/h6H,2-5H2,1H3 |
| InChIKey | SBHUAHIIUUSHEN-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|