C16H19N5O6 — CID 25108192
dimethyl (4S)-4-(azidomethyl)-1-(4-methoxycarbonylphenyl)imidazolidine-2,2-dicarboxylate (PubChem CID 25108192) has the molecular formula C16H19N5O6 and a molecular weight of 377.36 g/mol. Its IUPAC name is dimethyl (4S)-4-(azidomethyl)-1-(4-methoxycarbonylphenyl)imidazolidine-2,2-dicarboxylate.
| Compound Name | dimethyl (4S)-4-(azidomethyl)-1-(4-methoxycarbonylphenyl)imidazolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 25108192 |
| Molecular Formula | C16H19N5O6 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | dimethyl (4S)-4-(azidomethyl)-1-(4-methoxycarbonylphenyl)imidazolidine-2,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(N2C[C@@H](CN=[N+]=[N-])NC2(C(=O)OC)C(=O)OC)cc1 |
| InChI | InChI=1S/C16H19N5O6/c1-25-13(22)10-4-6-12(7-5-10)21-9-11(8-18-20-17)19-16(21,14(23)26-2)15(24)27-3/h4-7,11,19H,8-9H2,1-3H3/t11-/m1/s1 |
| InChIKey | VHYMNSASLNRLMG-LLVKDONJSA-N |
| XLogP | 0.60 |
| TPSA | 142.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|